CAS 898786-48-6
:5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(2-methoxyphenyl)pentan-1-one
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(2-methoxyphenyl)pentan-1-one, with the CAS number 898786-48-6, is a synthetic organic compound characterized by its complex structure that includes a dioxane ring and a ketone functional group. This compound features a pentanone backbone, which contributes to its potential applications in various chemical reactions and synthesis processes. The presence of the methoxyphenyl group enhances its aromatic properties, potentially influencing its reactivity and solubility in organic solvents. The dioxane moiety may impart stability and specific steric effects, which can be significant in biological or chemical interactions. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this nature typically exhibit moderate to high lipophilicity due to their hydrophobic aromatic and aliphatic components. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or as an intermediate in organic synthesis. As with all chemical substances, proper handling and safety precautions should be observed.
Formula:C18H26O4
InChI:InChI=1/C18H26O4/c1-18(2)12-21-17(22-13-18)11-7-5-9-15(19)14-8-4-6-10-16(14)20-3/h4,6,8,10,17H,5,7,9,11-13H2,1-3H3
SMILES:CC1(C)COC(CCCCC(=O)c2ccccc2OC)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.