CymitQuimica logo

CAS 898786-50-0

:

[4-(6-chloropyridine-3-carbonyl)phenyl] acetate

Description:
[4-(6-chloropyridine-3-carbonyl)phenyl] acetate, with the CAS number 898786-50-0, is an organic compound characterized by its complex structure that includes a phenyl ring, an acetate group, and a chloropyridine moiety. This compound typically exhibits properties common to aromatic esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The chloropyridine component may impart unique electronic properties and influence the compound's biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological targets. Additionally, the presence of the acetate group may enhance its lipophilicity, affecting its absorption and distribution in biological systems. Overall, [4-(6-chloropyridine-3-carbonyl)phenyl] acetate represents a versatile chemical entity with potential utility in various chemical and biological applications.
Formula:C14H10ClNO3
InChI:InChI=1/C14H10ClNO3/c1-9(17)19-12-5-2-10(3-6-12)14(18)11-4-7-13(15)16-8-11/h2-8H,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)c1ccc(Cl)nc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.