CAS 898786-51-1
:5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(3-methoxyphenyl)-1-pentanone
Description:
5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(3-methoxyphenyl)-1-pentanone, with the CAS number 898786-51-1, is an organic compound characterized by its complex structure, which includes a dioxane ring and a ketone functional group. The presence of the dioxane moiety contributes to its potential solubility in organic solvents and may influence its reactivity and stability. The methoxyphenyl group enhances its aromatic characteristics, potentially affecting its electronic properties and interactions with other molecules. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. As with many organic compounds, safety precautions should be taken when handling it, as its specific toxicity and environmental impact would need to be assessed in detail.
Formula:C18H26O4
InChI:InChI=1S/C18H26O4/c1-18(2)12-21-17(22-13-18)10-5-4-9-16(19)14-7-6-8-15(11-14)20-3/h6-8,11,17H,4-5,9-10,12-13H2,1-3H3
InChI key:InChIKey=OUFJUIJNBITYOC-UHFFFAOYSA-N
SMILES:C(CCCCC1OCC(C)(C)CO1)(=O)C2=CC(OC)=CC=C2
Synonyms:- 5-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(3-methoxyphenyl)-1-pentanone
- 1-Pentanone, 5-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.