CymitQuimica logo

CAS 898786-57-7

:

3-(1,3-dioxan-2-yl)-1-[3-(trifluoromethyl)phenyl]propan-1-one

Description:
3-(1,3-Dioxan-2-yl)-1-[3-(trifluoromethyl)phenyl]propan-1-one, with the CAS number 898786-57-7, is an organic compound characterized by its complex structure that includes a dioxane ring and a trifluoromethyl-substituted phenyl group. The presence of the dioxane moiety suggests that it may exhibit properties such as solubility in polar solvents and potential reactivity due to the ether functionalities. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing the compound's biological activity. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as an intermediate in synthetic pathways. Its molecular structure indicates that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, making it a versatile building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C14H15F3O3
InChI:InChI=1/C14H15F3O3/c15-14(16,17)11-4-1-3-10(9-11)12(18)5-6-13-19-7-2-8-20-13/h1,3-4,9,13H,2,5-8H2
SMILES:c1cc(cc(c1)C(F)(F)F)C(=O)CCC1OCCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.