CAS 898786-63-5

4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-[3-(trifluoromethyl)phenyl]butan-1-one

Description:

4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-[3-(trifluoromethyl)phenyl]butan-1-one, with the CAS number 898786-63-5, is an organic compound characterized by its complex molecular structure, which includes a dioxane ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with ketones, such as being a polar solvent with potential applications in organic synthesis and pharmaceuticals. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The dioxane moiety contributes to its stability and solubility in various organic solvents. Additionally, the compound may exhibit unique reactivity patterns due to the steric and electronic effects of its substituents. Overall, this substance is a representative example of a complex organic molecule that could be explored for various applications in chemical research and development.

Formula: C₁₇H₂₁F₃O₃

InChI: InChI=1/C17H21F3O3/c1-16(2)10-22-15(23-11-16)8-4-7-14(21)12-5-3-6-13(9-12)17(18,19)20/h3,5-6,9,15H,4,7-8,10-11H2,1-2H3

SMILES: CC1(C)COC(CCCC(=O)c2cccc(c2)C(F)(F)F)OC1

4-(5,5-dimethyl-1,3-dioxan-2-yl)-3′-trifluoromethylbutyrophenone

CAS: 898786-63-5

Formula: C₁₇H₂₁F₃O₃

Purity: 97.0%

Molecular weight: 330.347

Ref: 10-F208343