CAS 898786-75-9
:4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-methoxy-3,5-dimethyl-phenyl)butan-1-one
Description:
4-(5,5-Dimethyl-1,3-dioxan-2-yl)-1-(4-methoxy-3,5-dimethyl-phenyl)butan-1-one, with the CAS number 898786-75-9, is a synthetic organic compound characterized by its complex structure, which includes a dioxane ring and a butanone moiety. This compound features a dioxan-2-yl group that contributes to its stability and solubility in organic solvents. The presence of a methoxy group and multiple methyl substituents on the phenyl ring enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors. The compound is likely to exhibit moderate to high molecular weight and may possess unique chemical reactivity due to the functional groups present. Its specific applications and biological properties would depend on further empirical studies, but compounds of this nature are often explored in fields such as pharmaceuticals, agrochemicals, or materials science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C19H28O4
InChI:InChI=1/C19H28O4/c1-13-9-15(10-14(2)18(13)21-5)16(20)7-6-8-17-22-11-19(3,4)12-23-17/h9-10,17H,6-8,11-12H2,1-5H3
SMILES:Cc1cc(cc(C)c1OC)C(=O)CCCC1OCC(C)(C)CO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.