CymitQuimica logo

CAS 898786-88-4

:

1-(2,5-difluorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one

Description:
1-(2,5-Difluorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one, with the CAS number 898786-88-4, is a synthetic organic compound characterized by its complex structure, which includes a butanone moiety linked to a difluorophenyl group and a dioxane derivative. This compound typically exhibits properties common to ketones, such as being a polar solvent with potential solubility in organic solvents. The presence of fluorine atoms in the phenyl ring can enhance its lipophilicity and influence its reactivity, making it of interest in medicinal chemistry and material science. The dioxane ring contributes to the compound's stability and may affect its biological activity. Additionally, the presence of bulky dimethyl groups can impact steric hindrance, influencing interactions with biological targets. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis, although specific biological or chemical properties would require further empirical investigation.
Formula:C16H20F2O3
InChI:InChI=1/C16H20F2O3/c1-16(2)9-20-15(21-10-16)5-3-4-14(19)12-8-11(17)6-7-13(12)18/h6-8,15H,3-5,9-10H2,1-2H3
SMILES:CC1(C)COC(CCCC(=O)c2cc(ccc2F)F)OC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.