CymitQuimica logo

CAS 898786-91-9

:

[3-(5-chloropentanoyl)phenyl] acetate

Description:
[3-(5-chloropentanoyl)phenyl] acetate, identified by its CAS number 898786-91-9, is an organic compound characterized by its phenyl ring substituted with an acyl group and an acetate moiety. The presence of the 5-chloropentanoyl group indicates that it contains a chlorinated aliphatic chain, which can influence its reactivity and physical properties. This compound is likely to exhibit moderate polarity due to the combination of the aromatic and aliphatic components, affecting its solubility in various solvents. The chlorinated segment may impart unique biological or chemical activities, making it of interest in pharmaceutical or agrochemical applications. Additionally, the acetate functional group suggests potential for esterification reactions, which could be relevant in synthetic chemistry. Overall, the characteristics of [3-(5-chloropentanoyl)phenyl] acetate make it a compound of interest for further study in organic synthesis and potential applications in various fields.
Formula:C13H15ClO3
InChI:InChI=1/C13H15ClO3/c1-10(15)17-12-6-4-5-11(9-12)13(16)7-2-3-8-14/h4-6,9H,2-3,7-8H2,1H3
SMILES:CC(=O)Oc1cccc(c1)C(=O)CCCCCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.