CAS 898786-94-2
:[4-(5-chloropentanoyl)phenyl] acetate
Description:
[4-(5-Chloropentanoyl)phenyl] acetate, with the CAS number 898786-94-2, is an organic compound characterized by its phenyl acetate structure modified with a 5-chloropentanoyl group. This compound features a phenyl ring substituted at the para position with an acyl chain that includes a chlorine atom, which can influence its reactivity and solubility. The presence of the chlorinated aliphatic chain may impart unique biological or chemical properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. The acetate functional group suggests that the compound may exhibit ester-like characteristics, such as volatility and potential reactivity with nucleophiles. Additionally, the chlorinated moiety can enhance lipophilicity, affecting the compound's interaction with biological membranes. Overall, [4-(5-chloropentanoyl)phenyl] acetate is a compound that combines aromatic and aliphatic features, which can lead to diverse chemical behavior and potential utility in synthetic chemistry or material science.
Formula:C13H15ClO3
InChI:InChI=1/C13H15ClO3/c1-10(15)17-12-7-5-11(6-8-12)13(16)4-2-3-9-14/h5-8H,2-4,9H2,1H3
SMILES:CC(=O)Oc1ccc(cc1)C(=O)CCCCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.