CAS 898786-98-6

1-Propanone, 3-(3-chlorophenyl)-1-(3-fluorophenyl)-

Description:

1-Propanone, 3-(3-chlorophenyl)-1-(3-fluorophenyl)-, also known by its CAS number 898786-98-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic substituents: a 3-chlorophenyl group and a 3-fluorophenyl group. The presence of halogen atoms, specifically chlorine and fluorine, contributes to its chemical reactivity and potential biological activity. The compound is likely to exhibit moderate polarity due to the electronegative halogens, which can influence its solubility in various solvents. Additionally, the aromatic rings may provide stability and influence the compound's interactions in biological systems. As a ketone, it may participate in nucleophilic addition reactions and can serve as a precursor in synthetic organic chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or materials science, warranting further investigation into its properties and uses.

Formula: C₁₅H₁₂ClFO

InChI: InChI=1/C15H12ClFO/c16-13-5-1-3-11(9-13)7-8-15(18)12-4-2-6-14(17)10-12/h1-6,9-10H,7-8H2

InChI key: InChIKey=SSOZIRPRMFPWQR-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Cl)=CC=C1)(=O)C2=CC(F)=CC=C2

Synonyms:

• 1-Propanone, 3-(3-chlorophenyl)-1-(3-fluorophenyl)-
• 3-(3-Chlorophenyl)-3′-fluoropropiophenone
• 3-(3-Chlorophenyl)-1-(3-fluorophenyl)-1-propanone