CymitQuimica logo

CAS 898787-00-3

:

3-(3-chlorophenyl)-1-(4-fluorophenyl)propan-1-one

Description:
3-(3-Chlorophenyl)-1-(4-fluorophenyl)propan-1-one, identified by its CAS number 898787-00-3, is an organic compound characterized by its ketone functional group and a propanone backbone. This compound features two aromatic rings: a chlorinated phenyl group at the 3-position and a fluorinated phenyl group at the 1-position of the propanone structure. The presence of halogen substituents, specifically chlorine and fluorine, can influence the compound's reactivity, polarity, and overall chemical behavior. Typically, such compounds may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the substituents and the overall molecular architecture. Safety and handling considerations are essential, as with many organic compounds, particularly those containing halogens, which may pose environmental and health risks.
Formula:C15H12ClFO
InChI:InChI=1/C15H12ClFO/c16-13-3-1-2-11(10-13)4-9-15(18)12-5-7-14(17)8-6-12/h1-3,5-8,10H,4,9H2
SMILES:c1cc(CCC(=O)c2ccc(cc2)F)cc(c1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.