CymitQuimica logo

CAS 898787-12-7

:

1-Propanone, 3-(3-chlorophenyl)-1-(3,4-dimethylphenyl)-

Description:
1-Propanone, 3-(3-chlorophenyl)-1-(3,4-dimethylphenyl)-, also known by its CAS number 898787-12-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 3-chlorophenyl group and a 3,4-dimethylphenyl group. The presence of the chlorine atom introduces a degree of polarity and can influence the compound's reactivity and solubility in various solvents. The dimethyl groups on the second aromatic ring can affect steric hindrance and electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. As a ketone, it may participate in various chemical reactions, including nucleophilic addition and oxidation. The compound's specific physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of substituents. Overall, this compound's unique structure suggests potential applications in organic synthesis and materials science, although specific applications would require further investigation.
Formula:C17H17ClO
InChI:InChI=1S/C17H17ClO/c1-12-6-8-15(10-13(12)2)17(19)9-7-14-4-3-5-16(18)11-14/h3-6,8,10-11H,7,9H2,1-2H3
InChI key:InChIKey=KWHBNTCUXWQUFC-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Cl)=CC=C1)(=O)C2=CC(C)=C(C)C=C2
Synonyms:
  • 1-Propanone, 3-(3-chlorophenyl)-1-(3,4-dimethylphenyl)-
  • 3-(3-Chlorophenyl)-3′,4′-dimethylpropiophenone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.