CAS 898787-13-8
:1-(4-butylphenyl)-3-(1,3-dioxan-2-yl)propan-1-one
Description:
1-(4-butylphenyl)-3-(1,3-dioxan-2-yl)propan-1-one, identified by its CAS number 898787-13-8, is an organic compound characterized by its unique molecular structure that includes a propanone backbone, a butylphenyl group, and a dioxane moiety. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature, with potential solubility in organic solvents. The presence of the dioxane ring suggests it may have interesting chemical reactivity and stability, potentially making it useful in various applications, including pharmaceuticals or as an intermediate in organic synthesis. Its butylphenyl substituent may impart hydrophobic characteristics, influencing its interactions in biological systems or materials science. Additionally, the compound's structure may allow for specific interactions with biological targets, making it a candidate for further research in medicinal chemistry. As with many organic compounds, safety data and handling precautions should be considered, as they can vary based on the specific functional groups present.
Formula:C17H24O3
InChI:InChI=1/C17H24O3/c1-2-3-5-14-6-8-15(9-7-14)16(18)10-11-17-19-12-4-13-20-17/h6-9,17H,2-5,10-13H2,1H3
SMILES:CCCCc1ccc(cc1)C(=O)CCC1OCCCO1
Synonyms:- 1-Propanone, 1-(4-Butylphenyl)-3-(1,3-Dioxan-2-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.