CymitQuimica logo

CAS 898787-16-1

:

1-(4-bromo-3-fluoro-phenyl)-3-(3-chlorophenyl)propan-1-one

Description:
1-(4-bromo-3-fluoro-phenyl)-3-(3-chlorophenyl)propan-1-one, identified by its CAS number 898787-16-1, is an organic compound characterized by its complex structure featuring multiple halogen substituents. This compound contains a propanone functional group, which is indicative of ketones, and is further substituted with a bromo and a fluoro group on one phenyl ring, and a chloro group on another. The presence of these halogens typically enhances the compound's reactivity and can influence its physical properties, such as solubility and boiling point. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple aromatic rings that can interact with biological targets. Additionally, the compound's unique halogen substitutions may impart specific electronic properties, making it a candidate for further research in various chemical reactions or as a building block in organic synthesis. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C15H11BrClFO
InChI:InChI=1/C15H11BrClFO/c16-13-6-5-11(9-14(13)18)15(19)7-4-10-2-1-3-12(17)8-10/h1-3,5-6,8-9H,4,7H2
SMILES:c1cc(CCC(=O)c2ccc(c(c2)F)Br)cc(c1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.