CAS 898787-18-3

1-(4-chloro-3-fluoro-phenyl)-3-(3-chlorophenyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(3-chlorophenyl)propan-1-one, with the CAS number 898787-18-3, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone, which is substituted with two distinct aromatic rings: one containing both chlorine and fluorine substituents, and the other bearing a chlorine atom. The presence of these halogen atoms can influence the compound's reactivity, polarity, and overall chemical behavior, making it of interest in various fields, including medicinal chemistry and materials science. The compound's molecular structure suggests potential applications in drug development or as an intermediate in organic synthesis. Additionally, its physical properties, such as solubility and melting point, would be influenced by the substituents on the aromatic rings, which can affect intermolecular interactions. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with halogenated substituents.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1/C15H11Cl2FO/c16-12-3-1-2-10(8-12)4-7-15(19)11-5-6-13(17)14(18)9-11/h1-3,5-6,8-9H,4,7H2

SMILES: c1cc(CCC(=O)c2ccc(c(c2)F)Cl)cc(c1)Cl

4′-chloro-3-(3-chlorophenyl)-3′-fluoropropiophenone

CAS: 898787-18-3

Formula: C₁₅H₁₁Cl₂FO

Purity: 97.0%

Molecular weight: 297.15

Ref: 10-F206175