CAS 898787-19-4

3-(1,3-dioxan-2-yl)-1-(4-heptylphenyl)propan-1-one

Description:

3-(1,3-Dioxan-2-yl)-1-(4-heptylphenyl)propan-1-one, with the CAS number 898787-19-4, is an organic compound characterized by its complex structure that includes a dioxane ring and a phenyl group with a heptyl substituent. This compound typically exhibits properties associated with ketones, such as being a liquid at room temperature, with potential applications in organic synthesis and materials science. The presence of the dioxane moiety suggests it may have good solubility in organic solvents, while the heptyl chain can influence its hydrophobic characteristics and potentially its biological activity. The compound may also display interesting photophysical properties, making it a candidate for use in photonic applications or as a precursor in the synthesis of more complex molecules. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity depending on exposure levels.

Formula: C₂₀H₃₀O₃

InChI: InChI=1/C20H30O3/c1-2-3-4-5-6-8-17-9-11-18(12-10-17)19(21)13-14-20-22-15-7-16-23-20/h9-12,20H,2-8,13-16H2,1H3

SMILES: CCCCCCCc1ccc(cc1)C(=O)CCC1OCCCO1