CAS 898787-20-7

1-(3-chloro-4-fluoro-phenyl)-3-(3-chlorophenyl)propan-1-one

Description:

1-(3-chloro-4-fluoro-phenyl)-3-(3-chlorophenyl)propan-1-one, with the CAS number 898787-20-7, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone, where the carbonyl group is attached to a propyl chain, and is substituted with two aromatic rings: one containing a chloro and a fluoro substituent, and the other containing a chloro substituent. The presence of halogen atoms (chlorine and fluorine) in the phenyl rings can influence the compound's reactivity, stability, and biological activity, often enhancing lipophilicity and altering electronic properties. This compound may be of interest in pharmaceutical research and development due to its potential biological activities, which could include antimicrobial or anticancer properties. Its synthesis and handling require standard laboratory safety protocols due to the presence of halogens, which can pose health risks. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility would need to be determined experimentally.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1/C15H11Cl2FO/c16-12-3-1-2-10(8-12)4-7-15(19)11-5-6-14(18)13(17)9-11/h1-3,5-6,8-9H,4,7H2

SMILES: c1cc(CCC(=O)c2ccc(c(c2)Cl)F)cc(c1)Cl

3′-chloro-3-(3-chlorophenyl)-4′-fluoropropiophenone

CAS: 898787-20-7

Formula: C₁₅H₁₁Cl₂FO

Purity: 97.0%

Molecular weight: 297.15

Ref: 10-F206176