CAS 898787-25-2
:1-(4-butylphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one
Description:
1-(4-butylphenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one, identified by its CAS number 898787-25-2, is a synthetic organic compound characterized by its complex structure, which includes a butylphenyl group and a dioxane moiety. This compound typically exhibits properties associated with ketones, such as being a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It is likely to be soluble in organic solvents like ethanol and acetone, while exhibiting limited solubility in water due to its hydrophobic characteristics. The presence of the dioxane ring suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as an intermediate in chemical reactions. Additionally, its unique structure may impart specific physical and chemical properties, such as stability under various conditions and potential reactivity with nucleophiles. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C20H30O3
InChI:InChI=1/C20H30O3/c1-4-5-7-16-10-12-17(13-11-16)18(21)8-6-9-19-22-14-20(2,3)15-23-19/h10-13,19H,4-9,14-15H2,1-3H3
SMILES:CCCCc1ccc(cc1)C(=O)CCCC1OCC(C)(C)CO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.