CAS 898787-26-3

1-Propanone, 3-(3-chlorophenyl)-1-[2-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3-chlorophenyl)-1-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and a 2-(trifluoromethyl)phenyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The chlorophenyl group may also impart unique electronic properties, affecting the compound's overall stability and interaction with other molecules. Typically, such compounds are of interest in various fields, including pharmaceuticals and agrochemicals, due to their potential biological activities. The molecular structure suggests that it may exhibit significant hydrophobic characteristics, which can influence its solubility and distribution in biological systems. Additionally, the presence of halogen atoms like chlorine and fluorine can enhance the compound's reactivity and stability, making it a subject of interest in synthetic organic chemistry.

Formula: C₁₆H₁₂ClF₃O

InChI: InChI=1S/C16H12ClF3O/c17-12-5-3-4-11(10-12)8-9-15(21)13-6-1-2-7-14(13)16(18,19)20/h1-7,10H,8-9H2

InChI key: InChIKey=KBYRWIKYZCJEQB-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Cl)=CC=C1)(=O)C2=C(C(F)(F)F)C=CC=C2

Synonyms:

• 3-(3-Chlorophenyl)-1-[2-(trifluoromethyl)phenyl]-1-propanone
• 1-Propanone, 3-(3-chlorophenyl)-1-[2-(trifluoromethyl)phenyl]-