CAS 898787-28-5

1-Propanone, 3-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 3-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and a 3-(trifluoromethyl)phenyl group. The presence of the chlorine and trifluoromethyl groups introduces significant electronegative characteristics, influencing the compound's reactivity and polarity. Typically, such compounds exhibit moderate to high lipophilicity due to their aromatic nature, which can affect their solubility in various solvents. The trifluoromethyl group is known for imparting unique electronic properties, often enhancing the compound's biological activity. Additionally, the compound may exhibit interesting thermal and chemical stability, making it of interest in various applications, including pharmaceuticals and agrochemicals. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or environmental impact. Overall, this compound's unique structure and substituents contribute to its potential utility in chemical synthesis and research.

Formula: C₁₆H₁₂ClF₃O

InChI: InChI=1S/C16H12ClF3O/c17-14-6-1-3-11(9-14)7-8-15(21)12-4-2-5-13(10-12)16(18,19)20/h1-6,9-10H,7-8H2

InChI key: InChIKey=PNCKRMYKAODNFR-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Cl)=CC=C1)(=O)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 1-Propanone, 3-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-
• 3-(3-Chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-1-propanone