CAS 898787-31-0

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-chlorophenyl)-

Description:

1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-chlorophenyl)-, identified by its CAS number 898787-31-0, is an organic compound characterized by its ketone functional group. This compound features a propanone backbone with two distinct aromatic substituents: a 4-bromo-2-fluorophenyl group and a 3-chlorophenyl group. The presence of halogen atoms (bromine, fluorine, and chlorine) in its structure suggests potential for varied reactivity and interactions, influencing its physical and chemical properties. Typically, such compounds exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their solubility in organic solvents. The presence of multiple halogens may also enhance the compound's stability and alter its electronic properties, making it of interest in fields such as medicinal chemistry and materials science. Additionally, the compound's specific reactivity can be influenced by the positions of the halogen substituents, which may affect its potential applications in synthesis or as a pharmaceutical agent.

Formula: C₁₅H₁₁BrClFO

InChI: InChI=1S/C15H11BrClFO/c16-11-5-6-13(14(18)9-11)15(19)7-4-10-2-1-3-12(17)8-10/h1-3,5-6,8-9H,4,7H2

InChI key: InChIKey=RBQRRYMRGPJKFY-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Cl)=CC=C1)(=O)C2=C(F)C=C(Br)C=C2

Synonyms:

• 4′-Bromo-3-(3-chlorophenyl)-2′-fluoropropiophenone
• 1-(4-Bromo-2-fluorophenyl)-3-(3-chlorophenyl)-1-propanone
• 1-Propanone, 1-(4-bromo-2-fluorophenyl)-3-(3-chlorophenyl)-

4′-bromo-3-(3-chlorophenyl)-2′-fluoropropiophenone

CAS: 898787-31-0

Formula: C₁₅H₁₁BrClFO

Purity: 97.0%

Molecular weight: 341.6

Ref: 10-F206182