CAS 898787-32-1

1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(3-chlorophenyl)-

Description:

1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(3-chlorophenyl)-, also known by its CAS number 898787-32-1, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 2-chloro-4-fluorophenyl group and a 3-chlorophenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its chemical reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity, which can influence their solubility in organic solvents and biological systems. Additionally, the halogen substituents can enhance the compound's stability and alter its electronic properties, potentially impacting its interactions in various chemical environments. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity, particularly in the presence of strong oxidizing agents or under extreme conditions.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1S/C15H11Cl2FO/c16-11-3-1-2-10(8-11)4-7-15(19)13-6-5-12(18)9-14(13)17/h1-3,5-6,8-9H,4,7H2

InChI key: InChIKey=QHEKYBBYHHUNLL-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Cl)=CC=C1)(=O)C2=C(Cl)C=C(F)C=C2

Synonyms:

• 1-Propanone, 1-(2-chloro-4-fluorophenyl)-3-(3-chlorophenyl)-
• 2′-Chloro-3-(3-chlorophenyl)-4′-fluoropropiophenone