CAS 898787-33-2
:1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-chlorophenyl)-
Description:
1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-chlorophenyl)-, identified by CAS number 898787-33-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 3-chlorophenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. The compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the electron-withdrawing effects of the halogen substituents. It may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential as a building block in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a complex structure with interesting chemical behavior and potential utility in various fields.
Formula:C15H11Cl2FO
InChI:InChI=1S/C15H11Cl2FO/c16-12-3-1-2-10(6-12)4-5-15(19)11-7-13(17)9-14(18)8-11/h1-3,6-9H,4-5H2
InChI key:InChIKey=OKJFFCASARURMK-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Cl)=CC=C1)(=O)C2=CC(Cl)=CC(F)=C2
Synonyms:- 1-(3-Chloro-5-fluorophenyl)-3-(3-chlorophenyl)-1-propanone
- 1-Propanone, 1-(3-chloro-5-fluorophenyl)-3-(3-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.