CAS 898787-36-5
:1-Propanone, 3-(3-chlorophenyl)-1-(2,4-dichlorophenyl)-
Description:
1-Propanone, 3-(3-chlorophenyl)-1-(2,4-dichlorophenyl)-, also known by its CAS number 898787-36-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and a 2,4-dichlorophenyl group. The presence of chlorine atoms in the aromatic rings enhances the compound's reactivity and may influence its physical properties, such as solubility and boiling point. Typically, compounds with such structures exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their behavior in biological systems and their potential applications in pharmaceuticals or agrochemicals. Additionally, the chlorinated phenyl groups may impart specific electronic properties, making this compound of interest in various chemical syntheses and research applications. Safety and handling considerations should be taken into account due to the potential toxicity associated with chlorinated organic compounds.
Formula:C15H11Cl3O
InChI:InChI=1S/C15H11Cl3O/c16-11-3-1-2-10(8-11)4-7-15(19)13-6-5-12(17)9-14(13)18/h1-3,5-6,8-9H,4,7H2
InChI key:InChIKey=SXKRHFALFNPZKN-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Cl)=CC=C1)(=O)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 3-(3-Chlorophenyl)-1-(2,4-dichlorophenyl)-1-propanone
- 1-Propanone, 3-(3-chlorophenyl)-1-(2,4-dichlorophenyl)-
- 3-(3-Chlorophenyl)-2′,4′-dichloropropiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.