CAS 898787-37-6

3-(3-chlorophenyl)-1-(2,5-dichlorophenyl)propan-1-one

Description:

3-(3-chlorophenyl)-1-(2,5-dichlorophenyl)propan-1-one, identified by its CAS number 898787-37-6, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features two aromatic rings: one with a chlorine substituent in the para position and another with two chlorine substituents at the 2 and 5 positions. The presence of these chlorinated phenyl groups contributes to its potential biological activity and lipophilicity, influencing its solubility and reactivity. The compound is likely to exhibit properties typical of ketones, such as being a polar solvent and participating in nucleophilic addition reactions. Its structural complexity suggests potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological properties and safety profile. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.

Formula: C₁₅H₁₁Cl₃O

InChI: InChI=1/C15H11Cl3O/c16-11-3-1-2-10(8-11)4-7-15(19)13-9-12(17)5-6-14(13)18/h1-3,5-6,8-9H,4,7H2

SMILES: c1cc(CCC(=O)c2cc(ccc2Cl)Cl)cc(c1)Cl