CAS 898787-38-7

3-(3-chlorophenyl)-1-(3,4-dichlorophenyl)propan-1-one

Description:

3-(3-chlorophenyl)-1-(3,4-dichlorophenyl)propan-1-one, with the CAS number 898787-38-7, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This substance features a propanone backbone substituted with two distinct chlorophenyl groups, which contribute to its chemical properties and potential biological activity. The presence of chlorine atoms on the phenyl rings enhances the compound's lipophilicity and may influence its reactivity and interaction with biological targets. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific arrangement of substituents can affect the compound's stability, solubility, and overall reactivity. Additionally, the chlorinated aromatic rings may impart unique electronic properties, making it a subject of interest in medicinal chemistry and materials science. Safety and handling considerations should be observed due to the presence of chlorine, which can pose environmental and health risks.

Formula: C₁₅H₁₁Cl₃O

InChI: InChI=1/C15H11Cl3O/c16-12-3-1-2-10(8-12)4-7-15(19)11-5-6-13(17)14(18)9-11/h1-3,5-6,8-9H,4,7H2

SMILES: c1cc(CCC(=O)c2ccc(c(c2)Cl)Cl)cc(c1)Cl