CymitQuimica logo

CAS 898787-41-2

:

Ethyl 5-(2,2,2-trifluoroacetyl)-2-furancarboxylate

Description:
Ethyl 5-(2,2,2-trifluoroacetyl)-2-furancarboxylate is an organic compound characterized by its unique structure, which includes a furan ring and a trifluoroacetyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive odor. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic furan ring. The presence of the trifluoroacetyl group imparts notable chemical reactivity, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and agrochemicals. Ethyl 5-(2,2,2-trifluoroacetyl)-2-furancarboxylate may exhibit biological activity, and its derivatives can be explored for potential pharmacological properties. As with many fluorinated compounds, it may also display unique physical and chemical properties, such as increased lipophilicity and altered metabolic pathways. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C9H7F3O4
InChI:InChI=1/C9H7F3O4/c1-2-15-8(14)6-4-3-5(16-6)7(13)9(10,11)12/h3-4H,2H2,1H3
InChI key:InChIKey=NCAOGPVUVXZUCU-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C=1OC(C(OCC)=O)=CC1
Synonyms:
  • 2-Furancarboxylic acid, 5-(2,2,2-trifluoroacetyl)-, ethyl ester
  • Ethyl 5-(2,2,2-trifluoroacetyl)-2-furancarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.