CymitQuimica logo

CAS 898787-43-4

:

1,1,1-trifluoro-3-(4-phenylphenyl)propan-2-one

Description:
1,1,1-Trifluoro-3-(4-phenylphenyl)propan-2-one, with the CAS number 898787-43-4, is an organic compound characterized by its unique trifluoromethyl group and a ketone functional group. This compound features a propanone backbone, where the carbonyl group is flanked by a trifluoromethyl group at one end and a phenyl-substituted phenyl group at the other. The presence of the trifluoromethyl group imparts significant polarity and can enhance the compound's reactivity, making it useful in various synthetic applications. The phenyl groups contribute to the compound's aromatic character, which can influence its solubility and interaction with other molecules. Typically, such compounds exhibit interesting electronic properties and can be utilized in materials science, pharmaceuticals, or as intermediates in organic synthesis. Additionally, the presence of fluorine atoms often enhances thermal stability and alters the compound's physical properties, such as boiling and melting points, compared to their non-fluorinated counterparts. Overall, this compound's structure suggests potential utility in diverse chemical applications.
Formula:C15H11F3O
InChI:InChI=1/C15H11F3O/c16-15(17,18)14(19)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2
SMILES:c1ccc(cc1)c1ccc(cc1)CC(=O)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.