CAS 898787-46-7
:1-Propanone, 3-(3-chlorophenyl)-1-(3,5-difluorophenyl)-
Description:
1-Propanone, 3-(3-chlorophenyl)-1-(3,5-difluorophenyl)-, also known by its CAS number 898787-46-7, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and a 3,5-difluorophenyl group. The presence of halogen atoms, specifically chlorine and fluorine, contributes to its chemical reactivity and potential biological activity. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can influence its solubility and interaction with biological membranes. Additionally, the presence of multiple substituents can affect its electronic properties, potentially making it a candidate for various applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose environmental and health risks.
Formula:C15H11ClF2O
InChI:InChI=1S/C15H11ClF2O/c16-12-3-1-2-10(6-12)4-5-15(19)11-7-13(17)9-14(18)8-11/h1-3,6-9H,4-5H2
InChI key:InChIKey=WXSUJFXGDUONEM-UHFFFAOYSA-N
SMILES:C(CCC1=CC(Cl)=CC=C1)(=O)C2=CC(F)=CC(F)=C2
Synonyms:- 3-(3-Chlorophenyl)-3′,5′-difluoropropiophenone
- 1-Propanone, 3-(3-chlorophenyl)-1-(3,5-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.