CAS 898787-48-9

1-Propanone, 3-(3-chlorophenyl)-1-(3,4,5-trifluorophenyl)-

Description:

1-Propanone, 3-(3-chlorophenyl)-1-(3,4,5-trifluorophenyl)-, also known by its CAS number 898787-48-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chlorophenyl group and a 3,4,5-trifluorophenyl group. The presence of chlorine and multiple fluorine atoms in the aromatic rings contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The trifluoromethyl groups can enhance the compound's stability and influence its reactivity, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological targets. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₁₀ClF₃O

InChI: InChI=1/C15H10ClF3O/c16-11-3-1-2-9(6-11)4-5-14(20)10-7-12(17)15(19)13(18)8-10/h1-3,6-8H,4-5H2

InChI key: InChIKey=YUGCOIZUEDUBOH-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Cl)=CC=C1)(=O)C2=CC(F)=C(F)C(F)=C2

Synonyms:

• 3-(3-Chlorophenyl)-1-(3,4,5-trifluorophenyl)-1-propanone
• 3-(3-Chlorophenyl)-3′,4′,5′-trifluoropropiophenone
• 1-Propanone, 3-(3-chlorophenyl)-1-(3,4,5-trifluorophenyl)-
• 3-(3-CHLOROPHENYL)-3',4',5'-TRIFLUOROPROPIOPHENONE

3-(3-chlorophenyl)-3′,4′,5′-trifluoropropiophenone

CAS: 898787-48-9

Formula: C₁₅H₁₀ClF₃O

Purity: 97.0%

Molecular weight: 298.69

Ref: 10-F206194