CAS 898787-63-8
:1,1,1-Trifluoro-3-(4-methoxy-2-methylphenyl)-2-propanone
Description:
1,1,1-Trifluoro-3-(4-methoxy-2-methylphenyl)-2-propanone, with the CAS number 898787-63-8, is a synthetic organic compound characterized by its trifluoromethyl and methoxy functional groups. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The methoxy and methyl substituents on the aromatic ring can affect the compound's electronic properties and steric hindrance, which may play a role in its interactions with biological targets. Typically, such compounds are evaluated for their stability, solubility, and potential toxicity, which are crucial for their application in various fields, including medicinal chemistry and agrochemicals. Overall, 1,1,1-Trifluoro-3-(4-methoxy-2-methylphenyl)-2-propanone represents a versatile structure that can be utilized in the development of novel chemical entities.
Formula:C11H11F3O2
InChI:InChI=1S/C11H11F3O2/c1-7-5-9(16-2)4-3-8(7)6-10(15)11(12,13)14/h3-5H,6H2,1-2H3
InChI key:InChIKey=UJYZZDGGRQIFRM-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)=O)C1=C(C)C=C(OC)C=C1
Synonyms:- 1,1,1-Trifluoro-3-(4-methoxy-2-methylphenyl)-2-propanone
- 2-Propanone, 1,1,1-trifluoro-3-(4-methoxy-2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.