CAS 898787-67-2
:1,1,1-trifluoro-3-(3-iodophenyl)propan-2-one
Description:
1,1,1-Trifluoro-3-(3-iodophenyl)propan-2-one is an organic compound characterized by its unique structure, which includes a trifluoromethyl group and an iodophenyl moiety. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The iodine atom in the phenyl ring can serve as a site for further chemical modifications, allowing for the development of derivatives with varied properties. Additionally, the compound's molecular structure suggests potential uses in agrochemicals or pharmaceuticals, particularly in the design of compounds with specific biological activities. Its CAS number, 898787-67-2, allows for easy identification and reference in chemical databases. Overall, this compound exemplifies the intersection of halogenated organic chemistry and functional group manipulation, making it a valuable subject for research and development in various chemical fields.
Formula:C9H6F3IO
InChI:InChI=1/C9H6F3IO/c10-9(11,12)8(14)5-6-2-1-3-7(13)4-6/h1-4H,5H2
SMILES:c1cc(cc(c1)I)CC(=O)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.