CymitQuimica logo

CAS 898787-71-8

:

3-(3-chloro-4-methyl-phenyl)-1,1,1-trifluoro-propan-2-one

Description:
3-(3-Chloro-4-methyl-phenyl)-1,1,1-trifluoro-propan-2-one, identified by its CAS number 898787-71-8, is a synthetic organic compound characterized by its unique trifluoromethyl and chloro-substituted aromatic structure. This compound features a propan-2-one backbone, which contributes to its ketone functional group, making it a potential candidate for various chemical reactions, including nucleophilic additions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and biological activity. The chloro and methyl substituents on the aromatic ring can affect the compound's electronic properties, potentially impacting its interaction with biological targets. This compound may be of interest in pharmaceutical research, agrochemicals, or materials science due to its distinctive properties. However, specific safety and handling guidelines should be followed, as halogenated compounds can exhibit varying degrees of toxicity and environmental persistence. As with any chemical, thorough characterization and understanding of its behavior in different environments are essential for its application.
Formula:C10H8ClF3O
InChI:InChI=1/C10H8ClF3O/c1-6-2-3-7(4-8(6)11)5-9(15)10(12,13)14/h2-4H,5H2,1H3
SMILES:Cc1ccc(cc1Cl)CC(=O)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.