CymitQuimica logo

CAS 898787-78-5

:

(2,3-dichlorophenyl)-[3-(thiomorpholinomethyl)phenyl]methanone

Description:
(2,3-Dichlorophenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898787-78-5, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a thiomorpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of chlorine atoms in the dichlorophenyl moiety can enhance lipophilicity and influence the compound's interaction with biological targets. The thiomorpholine ring introduces a heterocyclic element, which may impart unique pharmacological properties, such as improved solubility or altered metabolic pathways. As a ketone, it features a carbonyl group that can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential applications in targeting specific biological pathways or as a lead compound in the synthesis of more complex molecules. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C18H17Cl2NOS
InChI:InChI=1/C18H17Cl2NOS/c19-16-6-2-5-15(17(16)20)18(22)14-4-1-3-13(11-14)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2
SMILES:c1cc(cc(c1)C(=O)c1cccc(c1Cl)Cl)CN1CCSCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.