CAS 898787-79-6

1-Propanone, 3-(4-chlorophenyl)-1-[2-(methylthio)phenyl]-

Description:

1-Propanone, 3-(4-chlorophenyl)-1-[2-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with substituents that include a 4-chlorophenyl group and a 2-(methylthio)phenyl group, contributing to its unique chemical properties. The presence of the chlorophenyl group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. The methylthio group adds a sulfur atom, which can affect the compound's solubility and interaction with other molecules. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to their aromatic structures, potentially impacting their biological activity and pharmacokinetics. Additionally, the presence of multiple functional groups suggests that this compound could participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions. Overall, the specific characteristics of this compound would be further defined by its molecular interactions, stability under different conditions, and potential applications in fields such as medicinal chemistry or materials science.

Formula: C₁₆H₁₅ClOS

InChI: InChI=1S/C16H15ClOS/c1-19-16-5-3-2-4-14(16)15(18)11-8-12-6-9-13(17)10-7-12/h2-7,9-10H,8,11H2,1H3

InChI key: InChIKey=LCQPLOSNALVIIW-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Cl)C=C1)(=O)C2=C(SC)C=CC=C2

Synonyms:

• 3-(4-Chlorophenyl)-1-[2-(methylsulfanyl)phenyl]-1-propanone
• 1-Propanone, 3-(4-chlorophenyl)-1-[2-(methylthio)phenyl]-

3-(4-chlorophenyl)-2′-thiomethylpropiophenone

CAS: 898787-79-6

Formula: C₁₆H₁₅ClOS

Purity: 97.0%

Molecular weight: 290.81

Ref: 10-F206213