CAS 898787-82-1

1-Propanone, 3-(4-chlorophenyl)-1-[4-(methylthio)phenyl]-

Description:

1-Propanone, 3-(4-chlorophenyl)-1-[4-(methylthio)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two aromatic substituents: a 4-chlorophenyl group and a 4-(methylthio)phenyl group. The presence of the chlorinated aromatic ring contributes to its potential reactivity and biological activity, while the methylthio group may influence its solubility and interaction with other molecules. Typically, compounds of this nature are studied for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit properties such as moderate volatility and potential hydrophobicity due to the aromatic rings. Additionally, the presence of halogens and sulfur can affect the compound's electronic properties, making it of interest in various chemical and biological contexts. Safety and handling considerations should be taken into account, as with many organic compounds, particularly those with halogen and sulfur substituents.

Formula: C₁₆H₁₅ClOS

InChI: InChI=1S/C16H15ClOS/c1-19-15-9-5-13(6-10-15)16(18)11-4-12-2-7-14(17)8-3-12/h2-3,5-10H,4,11H2,1H3

InChI key: InChIKey=VFZYSJQBRPRVIA-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Cl)C=C1)(=O)C2=CC=C(SC)C=C2

Synonyms:

• 3-(4-Chlorophenyl)-1-[4-(methylsulfanyl)phenyl]-1-propanone
• 1-Propanone, 3-(4-chlorophenyl)-1-[4-(methylthio)phenyl]-

3-(4-chlorophenyl)-4′-thiomethylpropiophenone

CAS: 898787-82-1

Formula: C₁₆H₁₅ClOS

Purity: 97.0%

Molecular weight: 290.81

Ref: 10-F206214