CAS 898787-83-2
:7-(4-bromophenyl)-7-oxo-heptanoic acid
Description:
7-(4-Bromophenyl)-7-oxo-heptanoic acid is a chemical compound characterized by its unique structure, which includes a heptanoic acid backbone with a ketone functional group and a para-bromophenyl substituent. This compound features a seven-carbon chain (heptanoic acid) with a carboxylic acid group at one end, contributing to its acidic properties. The presence of the bromophenyl group enhances its potential for various applications, including in pharmaceuticals and organic synthesis, due to the reactivity of the bromine atom and the aromatic nature of the phenyl ring. The ketone functional group (7-oxo) indicates that there is a carbonyl group (C=O) located at the seventh carbon of the heptanoic chain, which can influence the compound's reactivity and interactions with other molecules. Overall, this compound's structure suggests it may exhibit interesting biological activities and could serve as a valuable intermediate in chemical synthesis.
Formula:C13H15BrO3
InChI:InChI=1/C13H15BrO3/c14-11-8-6-10(7-9-11)12(15)4-2-1-3-5-13(16)17/h6-9H,1-5H2,(H,16,17)
SMILES:C(CCC(=O)c1ccc(cc1)Br)CCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.