CAS 898787-84-3

(2,5-dichlorophenyl)-[3-(thiomorpholinomethyl)phenyl]methanone

Description:

The chemical substance known as (2,5-dichlorophenyl)-[3-(thiomorpholinomethyl)phenyl]methanone, with the CAS number 898787-84-3, is a synthetic organic compound characterized by its complex structure that includes a dichlorophenyl group and a thiomorpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility, stability, and reactivity. The presence of chlorine atoms in the dichlorophenyl moiety can enhance the compound's lipophilicity and potentially its biological activity. The thiomorpholine ring contributes to the compound's overall three-dimensional conformation and may affect its interaction with biological targets. Such compounds are often studied for their potential pharmaceutical applications, particularly in medicinal chemistry, due to their ability to modulate biological pathways. Additionally, the presence of functional groups in the structure may allow for further derivatization, making it a versatile candidate for research in drug development and related fields.

Formula: C₁₈H₁₇Cl₂NOS

InChI: InChI=1/C18H17Cl2NOS/c19-15-4-5-17(20)16(11-15)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

SMILES: c1cc(cc(c1)C(=O)c1cc(ccc1Cl)Cl)CN1CCSCC1