CAS 898787-87-6

Methanone, (3,4-dichlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (3,4-dichlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 3,4-dichlorophenyl moiety indicates that it has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. The compound also features a thiomorpholine group, which is a six-membered ring containing sulfur and nitrogen, contributing to its potential pharmacological properties. This compound may exhibit various characteristics such as lipophilicity due to its aromatic components, which can affect its solubility and permeability in biological systems. Additionally, the presence of halogen atoms like chlorine can enhance its reactivity and stability. Methanone derivatives are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₈H₁₇Cl₂NOS

InChI: InChI=1S/C18H17Cl2NOS/c19-16-5-4-15(11-17(16)20)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

InChI key: InChIKey=WKTBYZRWYYNFLO-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• 3,4-Dichloro-3′-thiomorpholinomethyl benzophenone
• Methanone, (3,4-dichlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-
• (3,4-Dichlorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone