CAS 898787-88-7

1-Propanone, 1-(3-chlorophenyl)-3-(4-chlorophenyl)-

Description:

1-Propanone, 1-(3-chlorophenyl)-3-(4-chlorophenyl)-, also known by its CAS number 898787-88-7, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two chlorophenyl substituents, specifically a 3-chlorophenyl group and a 4-chlorophenyl group, contributing to its unique chemical properties. The presence of chlorine atoms enhances the compound's reactivity and influences its physical properties, such as solubility and boiling point. Typically, compounds with chlorinated aromatic rings exhibit increased lipophilicity, which can affect their behavior in biological systems. This substance may be utilized in various chemical syntheses or as an intermediate in the production of more complex molecules. As with many organic compounds, safety precautions should be observed when handling it, as chlorinated compounds can pose environmental and health risks. Overall, 1-Propanone, 1-(3-chlorophenyl)-3-(4-chlorophenyl)- is a notable compound in organic chemistry with potential applications in research and industry.

Formula: C₁₅H₁₂Cl₂O

InChI: InChI=1S/C15H12Cl2O/c16-13-7-4-11(5-8-13)6-9-15(18)12-2-1-3-14(17)10-12/h1-5,7-8,10H,6,9H2

InChI key: InChIKey=AYVZMPDZZNOQRJ-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Cl)C=C1)(=O)C2=CC(Cl)=CC=C2

Synonyms:

• 1-Propanone, 1-(3-chlorophenyl)-3-(4-chlorophenyl)-
• 1-(3-Chlorophenyl)-3-(4-chlorophenyl)-1-propanone
• 3′-Chloro-3-(4-chlorophenyl)propiophenone