CAS 898787-93-4

Methanone, (2,4-difluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-

Description:

Methanone, (2,4-difluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]- is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the difluorophenyl group indicates that the compound has two fluorine atoms substituted on the phenyl ring, which can influence its electronic properties and reactivity. The thiomorpholine moiety suggests that the compound contains a sulfur atom within a morpholine ring, contributing to its potential biological activity and solubility characteristics. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a candidate for research in medicinal chemistry. Its CAS number, 898787-93-4, allows for easy identification and retrieval of information regarding its synthesis, properties, and potential applications. Overall, the combination of functional groups and substituents in this compound suggests a diverse range of chemical behavior and potential utility in various fields, including pharmaceuticals and materials science.

Formula: C₁₈H₁₇F₂NOS

InChI: InChI=1S/C18H17F2NOS/c19-15-4-5-16(17(20)11-15)18(22)14-3-1-2-13(10-14)12-21-6-8-23-9-7-21/h1-5,10-11H,6-9,12H2

InChI key: InChIKey=HZJXXROQFNJPOT-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C2=CC(CN3CCSCC3)=CC=C2

Synonyms:

• Methanone, (2,4-difluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]-
• (2,4-Difluorophenyl)[3-(4-thiomorpholinylmethyl)phenyl]methanone
• 2,4-Difluoro-3′-thiomorpholinomethyl benzophenone