CAS 898787-95-6
:7-(4-fluorophenyl)-7-oxo-heptanoic acid
Description:
7-(4-Fluorophenyl)-7-oxo-heptanoic acid is a chemical compound characterized by its unique structure, which includes a heptanoic acid backbone with a ketone functional group at the seventh carbon and a para-fluorophenyl group attached to the same carbon. This compound is typically classified as an aromatic carboxylic acid due to the presence of the carboxylic acid functional group (-COOH) and the aromatic fluorophenyl substituent. The fluorine atom in the para position can influence the compound's reactivity, polarity, and biological activity, making it of interest in medicinal chemistry and drug development. The presence of the ketone group contributes to its potential as a versatile intermediate in organic synthesis. Additionally, the compound's molecular structure suggests it may exhibit specific interactions with biological targets, which could be relevant for pharmacological applications. Overall, 7-(4-fluorophenyl)-7-oxo-heptanoic acid represents a compound with significant potential for further research in various chemical and biological fields.
Formula:C13H15FO3
InChI:InChI=1/C13H15FO3/c14-11-8-6-10(7-9-11)12(15)4-2-1-3-5-13(16)17/h6-9H,1-5H2,(H,16,17)
SMILES:C(CCC(=O)c1ccc(cc1)F)CCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.