CAS 898787-97-8

1-Propanone, 3-(4-chlorophenyl)-1-(2,4-dimethylphenyl)-

Description:

1-Propanone, 3-(4-chlorophenyl)-1-(2,4-dimethylphenyl)-, also known by its CAS number 898787-97-8, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 2,4-dimethylphenyl group. The presence of the chlorine atom in the para position of the phenyl ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The dimethyl groups on the second phenyl ring enhance its steric properties, influencing its interactions and solubility in organic solvents. Typically, compounds of this nature exhibit moderate to high lipophilicity, which can affect their bioavailability and environmental behavior. Additionally, the compound may display interesting optical and electronic properties due to the conjugation between the aromatic rings and the carbonyl group. Overall, 1-Propanone, 3-(4-chlorophenyl)-1-(2,4-dimethylphenyl)- is a complex molecule with potential utility in synthetic organic chemistry and material science.

Formula: C₁₇H₁₇ClO

InChI: InChI=1S/C17H17ClO/c1-12-3-9-16(13(2)11-12)17(19)10-6-14-4-7-15(18)8-5-14/h3-5,7-9,11H,6,10H2,1-2H3

InChI key: InChIKey=AGPKUEBDUGCJDG-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Cl)C=C1)(=O)C2=C(C)C=C(C)C=C2

Synonyms:

• 1-Propanone, 3-(4-chlorophenyl)-1-(2,4-dimethylphenyl)-
• 3-(4-Chlorophenyl)-2′,4′-dimethylpropiophenone

3-(4-chlorophenyl)-2′,4′-dimethylpropiophenone

CAS: 898787-97-8

Formula: C₁₇H₁₇ClO

Purity: 97.0%

Molecular weight: 272.77

Ref: 10-F206222