CAS 898788-00-6

3-(4-chlorophenyl)-1-(2,5-dimethylphenyl)propan-1-one

Description:

3-(4-chlorophenyl)-1-(2,5-dimethylphenyl)propan-1-one, also known by its CAS number 898788-00-6, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 2,5-dimethylphenyl group. The presence of the chlorine atom on the phenyl ring can influence the compound's reactivity and physical properties, such as solubility and boiling point. The dimethyl substitution on the second phenyl ring contributes to steric hindrance, which may affect the compound's interactions in chemical reactions. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests that it may exhibit interesting biological activities, although specific biological data would require further investigation. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₇ClO

InChI: InChI=1/C17H17ClO/c1-12-3-4-13(2)16(11-12)17(19)10-7-14-5-8-15(18)9-6-14/h3-6,8-9,11H,7,10H2,1-2H3

SMILES: Cc1ccc(C)c(c1)C(=O)CCc1ccc(cc1)Cl

3-(4-chlorophenyl)-2′,5′-dimethylpropiophenone

CAS: 898788-00-6

Formula: C₁₇H₁₇ClO

Purity: 97.0%

Molecular weight: 272.77

Ref: 10-F206223