CAS 898788-05-1

Cyclopropyl[3-(4-thiomorpholinylmethyl)phenyl]methanone

Description:

Cyclopropyl[3-(4-thiomorpholinylmethyl)phenyl]methanone is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a thiomorpholine moiety. The presence of the cyclopropyl group contributes to the compound's rigidity and may influence its reactivity and interaction with biological targets. The thiomorpholine ring, which contains sulfur, can enhance the compound's solubility and may play a role in its pharmacological properties. This compound is likely to exhibit specific biological activities due to its structural components, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals, where it may act as a lead compound for further modifications. Additionally, the presence of functional groups can affect its stability, reactivity, and interaction with other molecules, which are crucial for understanding its behavior in biological systems. Overall, Cyclopropyl[3-(4-thiomorpholinylmethyl)phenyl]methanone represents a complex organic molecule with potential significance in chemical and biological research.

Formula: C₁₅H₁₉NOS

InChI: InChI=1S/C15H19NOS/c17-15(13-4-5-13)14-3-1-2-12(10-14)11-16-6-8-18-9-7-16/h1-3,10,13H,4-9,11H2

InChI key: InChIKey=AYSXEQHMFNQBOT-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CCSCC2)=CC=C1)C3CC3

Synonyms:

• Methanone, cyclopropyl[3-(4-thiomorpholinylmethyl)phenyl]-
• Cyclopropyl[3-(4-thiomorpholinylmethyl)phenyl]methanone

cyclopropyl 3-(thiomorpholinomethyl)phenyl ketone

CAS: 898788-05-1

Formula: C₁₅H₁₉NOS

Purity: 97.0%

Molecular weight: 261.38

Ref: 10-F204988