CAS 898788-09-5

1-Propanone, 3-(4-chlorophenyl)-1-(3,5-dimethylphenyl)-

Description:

1-Propanone, 3-(4-chlorophenyl)-1-(3,5-dimethylphenyl)-, also known by its CAS number 898788-09-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 4-chlorophenyl group and a 3,5-dimethylphenyl group. The presence of the chlorine atom introduces electronegativity, potentially influencing the compound's reactivity and polarity. The dimethyl groups on the phenyl ring can affect steric hindrance and electronic properties, which may impact its interactions in chemical reactions. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the overall structure. Safety data sheets would provide necessary handling and toxicity information, as with many organic compounds, caution is advised due to potential health hazards.

Formula: C₁₇H₁₇ClO

InChI: InChI=1S/C17H17ClO/c1-12-9-13(2)11-15(10-12)17(19)8-5-14-3-6-16(18)7-4-14/h3-4,6-7,9-11H,5,8H2,1-2H3

InChI key: InChIKey=YXRANZUQENNUSQ-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(Cl)C=C1)(=O)C2=CC(C)=CC(C)=C2

Synonyms:

• 1-Propanone, 3-(4-chlorophenyl)-1-(3,5-dimethylphenyl)-
• 3-(4-Chlorophenyl)-3′,5′-dimethylpropiophenone

3-(4-chlorophenyl)-3′,5′-dimethylpropiophenone

CAS: 898788-09-5

Formula: C₁₇H₁₇ClO

Purity: 97.0%

Molecular weight: 272.77

Ref: 10-F206226