CAS 898788-12-0

1-(4-bromo-3-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one

Description:

1-(4-bromo-3-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one, with the CAS number 898788-12-0, is an organic compound characterized by its complex structure featuring multiple halogen substituents. This compound contains a propanone functional group, which is indicative of ketones, and is further substituted with a bromo and a fluoro group on one phenyl ring, and a chloro group on another. The presence of these halogens often influences the compound's reactivity, polarity, and overall stability. Typically, such compounds exhibit significant biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the halogen substituents, which can affect intermolecular interactions. Overall, this compound exemplifies the diverse chemistry of halogenated organic molecules and their potential utility in various chemical applications.

Formula: C₁₅H₁₁BrClFO

InChI: InChI=1/C15H11BrClFO/c16-13-7-4-11(9-14(13)18)15(19)8-3-10-1-5-12(17)6-2-10/h1-2,4-7,9H,3,8H2

SMILES: c1cc(ccc1CCC(=O)c1ccc(c(c1)F)Br)Cl

4′-bromo-3-(4-chlorophenyl)-3′-fluoropropiophenone

CAS: 898788-12-0

Formula: C₁₅H₁₁BrClFO

Purity: 97.0%

Molecular weight: 341.6

Ref: 10-F206227