CAS 898788-13-1

7-[3,5-bis(trifluoromethyl)phenyl]-7-oxo-heptanoic acid

Description:

7-[3,5-bis(trifluoromethyl)phenyl]-7-oxo-heptanoic acid is a synthetic organic compound characterized by its unique structure, which includes a heptanoic acid backbone with a ketone functional group at the 7-position and a phenyl group substituted with two trifluoromethyl groups at the 3 and 5 positions. This compound is likely to exhibit significant lipophilicity due to the presence of the trifluoromethyl groups, which can enhance its biological activity and stability. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may act as a weak acid. Additionally, the compound's structure may confer interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its CAS number, 898788-13-1, allows for easy identification in chemical databases. Overall, the compound's unique functional groups and structure suggest potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₅H₁₄F₆O₃

InChI: InChI=1/C15H14F6O3/c16-14(17,18)10-6-9(7-11(8-10)15(19,20)21)12(22)4-2-1-3-5-13(23)24/h6-8H,1-5H2,(H,23,24)

SMILES: C(CCC(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F)CCC(=O)O

7-(3,5-ditrifluoromethylphenyl)-7-oxoheptanoic acid

CAS: 898788-13-1

Formula: C₁₅H₁₄F₆O₃

Purity: 97.0%

Molecular weight: 356.264

Ref: 10-F207102