CAS 898788-15-3

1-(4-chloro-3-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one

Description:

1-(4-chloro-3-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one, identified by its CAS number 898788-15-3, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two aromatic rings substituted with chlorine and fluorine atoms, contributing to its unique chemical properties. The presence of halogen substituents typically enhances the compound's reactivity and can influence its biological activity, making it of interest in pharmaceutical research. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic structure, which may affect its solubility in various solvents. Additionally, the specific arrangement of substituents can lead to distinct steric and electronic effects, impacting its interactions with biological targets. Safety data and handling precautions should be considered, as halogenated compounds can pose environmental and health risks. Overall, this compound's structural characteristics suggest potential applications in medicinal chemistry and materials science, warranting further investigation into its properties and uses.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1/C15H11Cl2FO/c16-12-5-1-10(2-6-12)3-8-15(19)11-4-7-13(17)14(18)9-11/h1-2,4-7,9H,3,8H2

SMILES: c1cc(ccc1CCC(=O)c1ccc(c(c1)F)Cl)Cl

4′-Chloro-3-(4-chlorophenyl)-3′-fluoropropiophenone

CAS: 898788-15-3

Formula: C₁₅H₁₁Cl₂FO

Purity: 97.0%

Molecular weight: 297.15

Ref: 10-F206228