CAS 898788-18-6

1-(3-chloro-4-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one

Description:

1-(3-chloro-4-fluoro-phenyl)-3-(4-chlorophenyl)propan-1-one, identified by its CAS number 898788-18-6, is a synthetic organic compound that belongs to the class of ketones. This compound features a propanone backbone with two aromatic substituents: a 3-chloro-4-fluorophenyl group and a 4-chlorophenyl group. The presence of halogen atoms (chlorine and fluorine) in its structure contributes to its unique chemical properties, including potential reactivity and biological activity. The compound is likely to exhibit moderate to high lipophilicity due to its aromatic rings, which can influence its solubility in organic solvents. Additionally, the presence of multiple halogens may impart specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and it may be utilized in various applications, including research in drug development or as an intermediate in organic synthesis. Safety and handling precautions should be observed due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₁₅H₁₁Cl₂FO

InChI: InChI=1/C15H11Cl2FO/c16-12-5-1-10(2-6-12)3-8-15(19)11-4-7-14(18)13(17)9-11/h1-2,4-7,9H,3,8H2

SMILES: c1cc(ccc1CCC(=O)c1ccc(c(c1)Cl)F)Cl